C10H11ClN6O3S2 — CID 137241807
1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)thiourea (PubChem CID 137241807) has the molecular formula C10H11ClN6O3S2 and a molecular weight of 362.82 g/mol. Its IUPAC name is 1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)thiourea.
| Compound Name | 1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)thiourea |
|---|---|
| PubChem CID | 137241807 |
| Molecular Formula | C10H11ClN6O3S2 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 1-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)thiourea |
| SMILES | O=c1[nH]c(NC(=S)N[C@@H]2CS(=O)(=O)C[C@H]2Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H11ClN6O3S2/c11-4-1-22(19,20)2-5(4)14-10(21)17-9-15-7-6(8(18)16-9)12-3-13-7/h3-5H,1-2H2,(H4,12,13,14,15,16,17,18,21)/t4-,5-/m1/s1 |
| InChIKey | INPHJLMPJYOLSR-RFZPGFLSSA-N |
| XLogP | -0.66 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|