C50H41NO11S — CID 53463267
[2,3,4,5-tetrabenzoyloxy-5-(3-benzoyl-1,3-thiazolidin-2-yl)pentyl] benzoate (PubChem CID 53463267) has the molecular formula C50H41NO11S and a molecular weight of 863.94 g/mol. Its IUPAC name is [2,3,4,5-tetrabenzoyloxy-5-(3-benzoyl-1,3-thiazolidin-2-yl)pentyl] benzoate.
| Compound Name | [2,3,4,5-tetrabenzoyloxy-5-(3-benzoyl-1,3-thiazolidin-2-yl)pentyl] benzoate |
|---|---|
| PubChem CID | 53463267 |
| Molecular Formula | C50H41NO11S |
| Molecular Weight | 863.94 g/mol |
| Exact Mass | 863.24 |
| IUPAC Name | [2,3,4,5-tetrabenzoyloxy-5-(3-benzoyl-1,3-thiazolidin-2-yl)pentyl] benzoate |
| SMILES | O=C(OCC(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C1SCCN1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H41NO11S/c52-44(34-19-7-1-8-20-34)51-31-32-63-45(51)43(62-50(57)39-29-17-6-18-30-39)42(61-49(56)38-27-15-5-16-28-38)41(60-48(55)37-25-13-4-14-26-37)40(59-47(54)36-23-11-3-12-24-36)33-58-46(53)35-21-9-2-10-22-35/h1-30,40-43,45H,31-33H2 |
| InChIKey | RZFPTDCWZWTUDL-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.94 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|